C7H8F3O2- — CID 152743663
5,5,5-trifluoro-2,4-dimethylpent-2-enoate (PubChem CID 152743663) has the molecular formula C7H8F3O2- and a molecular weight of 181.13 g/mol. Its IUPAC name is 5,5,5-trifluoro-2,4-dimethylpent-2-enoate.
| Compound Name | 5,5,5-trifluoro-2,4-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 152743663 |
| Molecular Formula | C7H8F3O2- |
| Molecular Weight | 181.13 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 5,5,5-trifluoro-2,4-dimethylpent-2-enoate |
| SMILES | CC(=CC(C)C(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C7H9F3O2/c1-4(6(11)12)3-5(2)7(8,9)10/h3,5H,1-2H3,(H,11,12)/p-1 |
| InChIKey | ALKNJNANHVNRIZ-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.13 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|