C18H15NO4 — CID 152744484
methyl 2-(11-acetylbenzo[c][1,5]benzoxazepin-6-ylidene)acetate (PubChem CID 152744484) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is methyl 2-(11-acetylbenzo[c][1,5]benzoxazepin-6-ylidene)acetate.
| Compound Name | methyl 2-(11-acetylbenzo[c][1,5]benzoxazepin-6-ylidene)acetate |
|---|---|
| PubChem CID | 152744484 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 2-(11-acetylbenzo[c][1,5]benzoxazepin-6-ylidene)acetate |
| SMILES | COC(=O)C=C1Oc2ccccc2N(C(C)=O)c2ccccc21 |
| InChI | InChI=1S/C18H15NO4/c1-12(20)19-14-8-4-3-7-13(14)17(11-18(21)22-2)23-16-10-6-5-9-15(16)19/h3-11H,1-2H3 |
| InChIKey | VDPZRDUBGJDMSK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|