C15H13NO2S — CID 152745054
2-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),5,7,9,11,14,16-heptaen-13-one (PubChem CID 152745054) has the molecular formula C15H13NO2S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),5,7,9,11,14,16-heptaen-13-one.
| Compound Name | 2-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),5,7,9,11,14,16-heptaen-13-one |
|---|---|
| PubChem CID | 152745054 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-oxa-3-thia-6-azabicyclo[12.4.0]octadeca-1(18),5,7,9,11,14,16-heptaen-13-one |
| SMILES | O=C1C=CC=CC=C/N=C/CSOc2ccccc21 |
| InChI | InChI=1S/C15H13NO2S/c17-14-8-3-1-2-6-10-16-11-12-19-18-15-9-5-4-7-13(14)15/h1-11H,12H2/b2-1?,8-3?,10-6?,16-11+ |
| InChIKey | CEVJRKYDCWDRBO-DUAGXJFNSA-N |
| XLogP | 3.61 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|