About 6,6-diethoxyheptane-2,5-dione
6,6-diethoxyheptane-2,5-dione (PubChem CID 15274605) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 6,6-diethoxyheptane-2,5-dione.
Molecular Properties
| Compound Name | 6,6-diethoxyheptane-2,5-dione |
| PubChem CID | 15274605 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 6,6-diethoxyheptane-2,5-dione |
| SMILES | CCOC(C)(OCC)C(=O)CCC(C)=O |
| InChI | InChI=1S/C11H20O4/c1-5-14-11(4,15-6-2)10(13)8-7-9(3)12/h5-8H2,1-4H3 |
| InChIKey | XZZWHXQOAYKWLI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6,6-diethoxyheptane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-diethoxyheptane-2,5-dione?
The IUPAC name of 6,6-diethoxyheptane-2,5-dione (CID 15274605) is 6,6-diethoxyheptane-2,5-dione.
What is the SMILES notation for 6,6-diethoxyheptane-2,5-dione?
The canonical SMILES for 6,6-diethoxyheptane-2,5-dione is CCOC(C)(OCC)C(=O)CCC(C)=O.
What is the InChIKey of 6,6-diethoxyheptane-2,5-dione?
The InChIKey is XZZWHXQOAYKWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-5-14-11(4,15-6-2)10(13)8-7-9(3)12/h5-8H2,1-4H3.
What are the key properties of 6,6-diethoxyheptane-2,5-dione?
6,6-diethoxyheptane-2,5-dione has a molecular weight of 216.28 g/mol, XLogP of 1.71, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-diethoxyheptane-2,5-dione is sourced from PubChem (CID 15274605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).