C34H35Cl2FN4O3 — CID 152747207
4-[4-[3-(2,4-dichlorophenyl)-5-[4-[(3-fluoroanilino)methyl]piperidine-1-carbonyl]-1-methylpyrrol-2-yl]phenoxy]butanamide (PubChem CID 152747207) has the molecular formula C34H35Cl2FN4O3 and a molecular weight of 637.58 g/mol. Its IUPAC name is 4-[4-[3-(2,4-dichlorophenyl)-5-[4-[(3-fluoroanilino)methyl]piperidine-1-carbonyl]-1-methylpyrrol-2-yl]phenoxy]butanamide.
| Compound Name | 4-[4-[3-(2,4-dichlorophenyl)-5-[4-[(3-fluoroanilino)methyl]piperidine-1-carbonyl]-1-methylpyrrol-2-yl]phenoxy]butanamide |
|---|---|
| PubChem CID | 152747207 |
| Molecular Formula | C34H35Cl2FN4O3 |
| Molecular Weight | 637.58 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | 4-[4-[3-(2,4-dichlorophenyl)-5-[4-[(3-fluoroanilino)methyl]piperidine-1-carbonyl]-1-methylpyrrol-2-yl]phenoxy]butanamide |
| SMILES | Cn1c(C(=O)N2CCC(CNc3cccc(F)c3)CC2)cc(-c2ccc(Cl)cc2Cl)c1-c1ccc(OCCCC(N)=O)cc1 |
| InChI | InChI=1S/C34H35Cl2FN4O3/c1-40-31(34(43)41-15-13-22(14-16-41)21-39-26-5-2-4-25(37)19-26)20-29(28-12-9-24(35)18-30(28)36)33(40)23-7-10-27(11-8-23)44-17-3-6-32(38)42/h2,4-5,7-12,18-20,22,39H,3,6,13-17,21H2,1H3,(H2,38,42) |
| InChIKey | UNQSVNMMKHMFGV-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.58 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|