C16H17F3O2Te — CID 15274724
(4Z)-2-(prop-2-enoxymethyl)-4-[[4-(trifluoromethyl)phenyl]tellanylmethylidene]oxolane (PubChem CID 15274724) has the molecular formula C16H17F3O2Te and a molecular weight of 425.90 g/mol. Its IUPAC name is (4Z)-2-(prop-2-enoxymethyl)-4-[[4-(trifluoromethyl)phenyl]tellanylmethylidene]oxolane.
| Compound Name | (4Z)-2-(prop-2-enoxymethyl)-4-[[4-(trifluoromethyl)phenyl]tellanylmethylidene]oxolane |
|---|---|
| PubChem CID | 15274724 |
| Molecular Formula | C16H17F3O2Te |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | (4Z)-2-(prop-2-enoxymethyl)-4-[[4-(trifluoromethyl)phenyl]tellanylmethylidene]oxolane |
| SMILES | C=CCOCC1C/C(=C/[Te]c2ccc(C(F)(F)F)cc2)CO1 |
| InChI | InChI=1S/C16H17F3O2Te/c1-2-7-20-10-14-8-12(9-21-14)11-22-15-5-3-13(4-6-15)16(17,18)19/h2-6,11,14H,1,7-10H2/b12-11- |
| InChIKey | WUWRXKHSBLTMOV-QXMHVHEDSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|