C20H25N5O4S — CID 152747453
1-[6-[[6-(ethylamino)-3-pyridinyl]-hydroxymethylidene]-7-oxo-4,5-dihydro-1,3-benzothiazol-2-yl]-3-(3-methoxypropyl)urea (PubChem CID 152747453) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is 1-[6-[[6-(ethylamino)-3-pyridinyl]-hydroxymethylidene]-7-oxo-4,5-dihydro-1,3-benzothiazol-2-yl]-3-(3-methoxypropyl)urea.
| Compound Name | 1-[6-[[6-(ethylamino)-3-pyridinyl]-hydroxymethylidene]-7-oxo-4,5-dihydro-1,3-benzothiazol-2-yl]-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 152747453 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[6-[[6-(ethylamino)-3-pyridinyl]-hydroxymethylidene]-7-oxo-4,5-dihydro-1,3-benzothiazol-2-yl]-3-(3-methoxypropyl)urea |
| SMILES | CCNc1ccc(C(O)=C2CCc3nc(NC(=O)NCCCOC)sc3C2=O)cn1 |
| InChI | InChI=1S/C20H25N5O4S/c1-3-21-15-8-5-12(11-23-15)16(26)13-6-7-14-18(17(13)27)30-20(24-14)25-19(28)22-9-4-10-29-2/h5,8,11,26H,3-4,6-7,9-10H2,1-2H3,(H,21,23)(H2,22,24,25,28) |
| InChIKey | NWHUQBGHELAEID-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|