C22H38F2O5 — CID 152747701
7-[(8S,9R)-8-[(3R)-4,4-difluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid (PubChem CID 152747701) has the molecular formula C22H38F2O5 and a molecular weight of 420.54 g/mol. Its IUPAC name is 7-[(8S,9R)-8-[(3R)-4,4-difluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid.
| Compound Name | 7-[(8S,9R)-8-[(3R)-4,4-difluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
|---|---|
| PubChem CID | 152747701 |
| Molecular Formula | C22H38F2O5 |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 7-[(8S,9R)-8-[(3R)-4,4-difluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
| SMILES | CCCCC(F)(F)[C@H](O)CC[C@H]1CCC2(OCCO2)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H38F2O5/c1-2-3-13-21(23,24)19(25)11-10-17-12-14-22(28-15-16-29-22)18(17)8-6-4-5-7-9-20(26)27/h17-19,25H,2-16H2,1H3,(H,26,27)/t17-,18+,19+/m0/s1 |
| InChIKey | ONVYEKAZYOUOSP-IPMKNSEASA-N |
| XLogP | 5.15 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|