C7H12F3NO3 — CID 15274818
N-tert-butyl-3,3,3-trifluoro-2,2-dihydroxypropanamide (PubChem CID 15274818) has the molecular formula C7H12F3NO3 and a molecular weight of 215.17 g/mol. Its IUPAC name is N-tert-butyl-3,3,3-trifluoro-2,2-dihydroxypropanamide.
| Compound Name | N-tert-butyl-3,3,3-trifluoro-2,2-dihydroxypropanamide |
|---|---|
| PubChem CID | 15274818 |
| Molecular Formula | C7H12F3NO3 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-tert-butyl-3,3,3-trifluoro-2,2-dihydroxypropanamide |
| SMILES | CC(C)(C)NC(=O)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO3/c1-5(2,3)11-4(12)6(13,14)7(8,9)10/h13-14H,1-3H3,(H,11,12) |
| InChIKey | BYJULUIGMDIRCW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|