C8H13N3O — CID 152748422
1-(cyclopropylmethyl)-4-imino-1,3-diazinan-2-one (PubChem CID 152748422) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-imino-1,3-diazinan-2-one.
| Compound Name | 1-(cyclopropylmethyl)-4-imino-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 152748422 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-imino-1,3-diazinan-2-one |
| SMILES | [H]/N=C1\CCN(CC2CC2)C(=O)N1 |
| InChI | InChI=1S/C8H13N3O/c9-7-3-4-11(8(12)10-7)5-6-1-2-6/h6H,1-5H2,(H2,9,10,12) |
| InChIKey | HCRHTGNBOHNVDE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|