C7H9F3INO2 — CID 15274856
2,2,2-trifluoro-N-[(2S,3R)-2-(iodomethyl)oxolan-3-yl]acetamide (PubChem CID 15274856) has the molecular formula C7H9F3INO2 and a molecular weight of 323.05 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2S,3R)-2-(iodomethyl)oxolan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2S,3R)-2-(iodomethyl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 15274856 |
| Molecular Formula | C7H9F3INO2 |
| Molecular Weight | 323.05 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2S,3R)-2-(iodomethyl)oxolan-3-yl]acetamide |
| SMILES | O=C(N[C@@H]1CCO[C@@H]1CI)C(F)(F)F |
| InChI | InChI=1S/C7H9F3INO2/c8-7(9,10)6(13)12-4-1-2-14-5(4)3-11/h4-5H,1-3H2,(H,12,13)/t4-,5-/m1/s1 |
| InChIKey | ROJPUPPBPVBWKO-RFZPGFLSSA-N |
| XLogP | 1.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.05 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|