C8HF13 — CID 15274880
(2Z,4Z)-1,1,1,2,6,6,6-heptafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene (PubChem CID 15274880) has the molecular formula C8HF13 and a molecular weight of 344.07 g/mol. Its IUPAC name is (2Z,4Z)-1,1,1,2,6,6,6-heptafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene.
| Compound Name | (2Z,4Z)-1,1,1,2,6,6,6-heptafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 15274880 |
| Molecular Formula | C8HF13 |
| Molecular Weight | 344.07 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | (2Z,4Z)-1,1,1,2,6,6,6-heptafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene |
| SMILES | F/C(=C(C(=C/C(F)(F)F)/C(F)(F)F)\C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8HF13/c9-4(8(19,20)21)3(7(16,17)18)2(6(13,14)15)1-5(10,11)12/h1H/b2-1-,4-3- |
| InChIKey | DPXNAJTXBVCZPB-LOKDLIDFSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.07 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|