About 1H-indol-4-yl piperazine-1-carboxylate
1H-indol-4-yl piperazine-1-carboxylate (PubChem CID 152749012) has the molecular formula C13H15N3O2
and a molecular weight of 245.28 g/mol. Its IUPAC name is 1H-indol-4-yl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 1H-indol-4-yl piperazine-1-carboxylate |
| PubChem CID | 152749012 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1H-indol-4-yl piperazine-1-carboxylate |
| SMILES | O=C(Oc1cccc2[nH]ccc12)N1CCNCC1 |
| InChI | InChI=1S/C13H15N3O2/c17-13(16-8-6-14-7-9-16)18-12-3-1-2-11-10(12)4-5-15-11/h1-5,14-15H,6-9H2 |
| InChIKey | ZTVOMTGFJFKOCS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-indol-4-yl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-4-yl piperazine-1-carboxylate?
The IUPAC name of 1H-indol-4-yl piperazine-1-carboxylate (CID 152749012) is 1H-indol-4-yl piperazine-1-carboxylate.
What is the SMILES notation for 1H-indol-4-yl piperazine-1-carboxylate?
The canonical SMILES for 1H-indol-4-yl piperazine-1-carboxylate is O=C(Oc1cccc2[nH]ccc12)N1CCNCC1.
What is the InChIKey of 1H-indol-4-yl piperazine-1-carboxylate?
The InChIKey is ZTVOMTGFJFKOCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2/c17-13(16-8-6-14-7-9-16)18-12-3-1-2-11-10(12)4-5-15-11/h1-5,14-15H,6-9H2.
What are the key properties of 1H-indol-4-yl piperazine-1-carboxylate?
1H-indol-4-yl piperazine-1-carboxylate has a molecular weight of 245.28 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-4-yl piperazine-1-carboxylate is sourced from PubChem (CID 152749012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).