About ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate
ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate (PubChem CID 152749612) has the molecular formula C12H22N2O2S2
and a molecular weight of 290.45 g/mol. Its IUPAC name is ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate.
Molecular Properties
| Compound Name | ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate |
| PubChem CID | 152749612 |
| Molecular Formula | C12H22N2O2S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate |
| SMILES | CCSCSC(=NO)C(C(=O)NC)C1(C)CCC1 |
| InChI | InChI=1S/C12H22N2O2S2/c1-4-17-8-18-11(14-16)9(10(15)13-3)12(2)6-5-7-12/h9,16H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | SEFRQIWIRKJDKA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|
Analyze ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate?
The IUPAC name of ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate (CID 152749612) is ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate.
What is the SMILES notation for ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate?
The canonical SMILES for ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate is CCSCSC(=NO)C(C(=O)NC)C1(C)CCC1.
What is the InChIKey of ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate?
The InChIKey is SEFRQIWIRKJDKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2S2/c1-4-17-8-18-11(14-16)9(10(15)13-3)12(2)6-5-7-12/h9,16H,4-8H2,1-3H3,(H,13,15).
What are the key properties of ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate?
ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate has a molecular weight of 290.45 g/mol, XLogP of 2.77, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethylsulfanylmethyl N-hydroxy-3-(methylamino)-2-(1-methylcyclobutyl)-3-oxopropanimidothioate is sourced from PubChem (CID 152749612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).