C10H12F4O2 — CID 15274981
2-(2-ethoxy-3,3,4,4-tetrafluorocyclobuten-1-yl)oxolane (PubChem CID 15274981) has the molecular formula C10H12F4O2 and a molecular weight of 240.20 g/mol. Its IUPAC name is 2-(2-ethoxy-3,3,4,4-tetrafluorocyclobuten-1-yl)oxolane.
| Compound Name | 2-(2-ethoxy-3,3,4,4-tetrafluorocyclobuten-1-yl)oxolane |
|---|---|
| PubChem CID | 15274981 |
| Molecular Formula | C10H12F4O2 |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-(2-ethoxy-3,3,4,4-tetrafluorocyclobuten-1-yl)oxolane |
| SMILES | CCOC1=C(C2CCCO2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H12F4O2/c1-2-15-8-7(6-4-3-5-16-6)9(11,12)10(8,13)14/h6H,2-5H2,1H3 |
| InChIKey | BIOATXHJUQTJOE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|