C22H40O2Si — CID 152750892
(1S,3S,4aR,7S,8S,8aS)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,7-dimethyl-3-[(E)-prop-1-enyl]-2,4,4a,7,8,8a-hexahydro-1H-naphthalen-1-ol (PubChem CID 152750892) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is (1S,3S,4aR,7S,8S,8aS)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,7-dimethyl-3-[(E)-prop-1-enyl]-2,4,4a,7,8,8a-hexahydro-1H-naphthalen-1-ol.
| Compound Name | (1S,3S,4aR,7S,8S,8aS)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,7-dimethyl-3-[(E)-prop-1-enyl]-2,4,4a,7,8,8a-hexahydro-1H-naphthalen-1-ol |
|---|---|
| PubChem CID | 152750892 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (1S,3S,4aR,7S,8S,8aS)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,7-dimethyl-3-[(E)-prop-1-enyl]-2,4,4a,7,8,8a-hexahydro-1H-naphthalen-1-ol |
| SMILES | C/C=C/[C@]1(C)C[C@H](O)[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C)C=C[C@H]2C1 |
| InChI | InChI=1S/C22H40O2Si/c1-9-12-22(6)13-17-11-10-16(2)18(20(17)19(23)14-22)15-24-25(7,8)21(3,4)5/h9-12,16-20,23H,13-15H2,1-8H3/b12-9+/t16-,17-,18-,19-,20-,22-/m0/s1 |
| InChIKey | ZVJFRHVDTZZCML-XIPBIYAJSA-N |
| XLogP | 5.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|