About 2,1-benzothiazepine
2,1-benzothiazepine (PubChem CID 152751532) has the molecular formula C9H7NS
and a molecular weight of 161.23 g/mol. Its IUPAC name is 2,1-benzothiazepine.
Molecular Properties
| Compound Name | 2,1-benzothiazepine |
| PubChem CID | 152751532 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 2,1-benzothiazepine |
| SMILES | C1=CSN=c2ccccc2=C1 |
| InChI | InChI=1S/C9H7NS/c1-2-6-9-8(4-1)5-3-7-11-10-9/h1-7H |
| InChIKey | ZUPWUWRIJPPASD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,1-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,1-benzothiazepine?
The IUPAC name of 2,1-benzothiazepine (CID 152751532) is 2,1-benzothiazepine.
What is the SMILES notation for 2,1-benzothiazepine?
The canonical SMILES for 2,1-benzothiazepine is C1=CSN=c2ccccc2=C1.
What is the InChIKey of 2,1-benzothiazepine?
The InChIKey is ZUPWUWRIJPPASD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS/c1-2-6-9-8(4-1)5-3-7-11-10-9/h1-7H.
What are the key properties of 2,1-benzothiazepine?
2,1-benzothiazepine has a molecular weight of 161.23 g/mol, XLogP of 1.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,1-benzothiazepine is sourced from PubChem (CID 152751532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).