C7H6F5O2- — CID 152752001
5,5,6,6,6-pentafluoro-2-methylhex-2-enoate (PubChem CID 152752001) has the molecular formula C7H6F5O2- and a molecular weight of 217.11 g/mol. Its IUPAC name is 5,5,6,6,6-pentafluoro-2-methylhex-2-enoate.
| Compound Name | 5,5,6,6,6-pentafluoro-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 152752001 |
| Molecular Formula | C7H6F5O2- |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 5,5,6,6,6-pentafluoro-2-methylhex-2-enoate |
| SMILES | CC(=CCC(F)(F)C(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C7H7F5O2/c1-4(5(13)14)2-3-6(8,9)7(10,11)12/h2H,3H2,1H3,(H,13,14)/p-1 |
| InChIKey | DCSMEHOYYUHUJN-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|