About 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine
2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine (PubChem CID 152752050) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine |
| PubChem CID | 152752050 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine |
| SMILES | Cc1cccc(C2(N)N=C(N)C=CN2)c1C |
| InChI | InChI=1S/C12H16N4/c1-8-4-3-5-10(9(8)2)12(14)15-7-6-11(13)16-12/h3-7,15H,14H2,1-2H3,(H2,13,16) |
| InChIKey | LENCIICBAFBJJX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine?
The IUPAC name of 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine (CID 152752050) is 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine.
What is the SMILES notation for 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine?
The canonical SMILES for 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine is Cc1cccc(C2(N)N=C(N)C=CN2)c1C.
What is the InChIKey of 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine?
The InChIKey is LENCIICBAFBJJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c1-8-4-3-5-10(9(8)2)12(14)15-7-6-11(13)16-12/h3-7,15H,14H2,1-2H3,(H2,13,16).
What are the key properties of 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine?
2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine has a molecular weight of 216.29 g/mol, XLogP of 0.85, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylphenyl)-1H-pyrimidine-2,4-diamine is sourced from PubChem (CID 152752050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).