C25H30F3NO4S — CID 152752539
[2,2-dimethyl-5-[2-[4-(3-phenylpropylsulfanyl)-3-(trifluoromethyl)phenyl]ethyl]-1,3-dioxan-5-yl]carbamic acid (PubChem CID 152752539) has the molecular formula C25H30F3NO4S and a molecular weight of 497.58 g/mol. Its IUPAC name is [2,2-dimethyl-5-[2-[4-(3-phenylpropylsulfanyl)-3-(trifluoromethyl)phenyl]ethyl]-1,3-dioxan-5-yl]carbamic acid.
| Compound Name | [2,2-dimethyl-5-[2-[4-(3-phenylpropylsulfanyl)-3-(trifluoromethyl)phenyl]ethyl]-1,3-dioxan-5-yl]carbamic acid |
|---|---|
| PubChem CID | 152752539 |
| Molecular Formula | C25H30F3NO4S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [2,2-dimethyl-5-[2-[4-(3-phenylpropylsulfanyl)-3-(trifluoromethyl)phenyl]ethyl]-1,3-dioxan-5-yl]carbamic acid |
| SMILES | CC1(C)OCC(CCc2ccc(SCCCc3ccccc3)c(C(F)(F)F)c2)(NC(=O)O)CO1 |
| InChI | InChI=1S/C25H30F3NO4S/c1-23(2)32-16-24(17-33-23,29-22(30)31)13-12-19-10-11-21(20(15-19)25(26,27)28)34-14-6-9-18-7-4-3-5-8-18/h3-5,7-8,10-11,15,29H,6,9,12-14,16-17H2,1-2H3,(H,30,31) |
| InChIKey | VEVKXTBZFRRCEQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|