[2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid

C10H7FN2O2S — CID 152752672

IUPAC[2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid
SMILESO=C(O)Nc1cnc(-c2ccccc2F)s1
InChIInChI=1S/C10H7FN2O2S/c11-7-4-2-1-3-6(7)9-12-5-8(16-9)13-10(14)15/h1-5,13H,(H,14,15)
InChIKeyXDARFZFMRCLSER-UHFFFAOYSA-N
MW238.24 g/mol
LogP3.04
Rot. Bonds2

About [2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid

[2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid (PubChem CID 152752672) has the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid.

Molecular Properties

Compound Name[2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid
PubChem CID152752672
Molecular FormulaC10H7FN2O2S
Molecular Weight238.24 g/mol
Exact Mass238.02
IUPAC Name[2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid
SMILESO=C(O)Nc1cnc(-c2ccccc2F)s1
InChIInChI=1S/C10H7FN2O2S/c11-7-4-2-1-3-6(7)9-12-5-8(16-9)13-10(14)15/h1-5,13H,(H,14,15)
InChIKeyXDARFZFMRCLSER-UHFFFAOYSA-N
XLogP3.04
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 53.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze [2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid?
The IUPAC name of [2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid (CID 152752672) is [2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid.
What is the SMILES notation for [2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid?
The canonical SMILES for [2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid is O=C(O)Nc1cnc(-c2ccccc2F)s1.
What is the InChIKey of [2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid?
The InChIKey is XDARFZFMRCLSER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2O2S/c11-7-4-2-1-3-6(7)9-12-5-8(16-9)13-10(14)15/h1-5,13H,(H,14,15).
What are the key properties of [2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid?
[2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid has a molecular weight of 238.24 g/mol, XLogP of 3.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-fluorophenyl)-1,3-thiazol-5-yl]carbamic acid is sourced from PubChem (CID 152752672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).