C13H20O — CID 15275343
2-(3,3-dimethylbut-1-ynyl)-5,5-dimethylcyclopent-2-en-1-ol (PubChem CID 15275343) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 2-(3,3-dimethylbut-1-ynyl)-5,5-dimethylcyclopent-2-en-1-ol.
| Compound Name | 2-(3,3-dimethylbut-1-ynyl)-5,5-dimethylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 15275343 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 2-(3,3-dimethylbut-1-ynyl)-5,5-dimethylcyclopent-2-en-1-ol |
| SMILES | CC(C)(C)C#CC1=CCC(C)(C)C1O |
| InChI | InChI=1S/C13H20O/c1-12(2,3)8-6-10-7-9-13(4,5)11(10)14/h7,11,14H,9H2,1-5H3 |
| InChIKey | XDNQABZSIGUYLU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|