C22H23NO3 — CID 152756855
1-(2-phenylmethoxyethyl)-2,3,4,9-tetrahydro-1H-carbazole-4-carboxylic acid (PubChem CID 152756855) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-(2-phenylmethoxyethyl)-2,3,4,9-tetrahydro-1H-carbazole-4-carboxylic acid.
| Compound Name | 1-(2-phenylmethoxyethyl)-2,3,4,9-tetrahydro-1H-carbazole-4-carboxylic acid |
|---|---|
| PubChem CID | 152756855 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-(2-phenylmethoxyethyl)-2,3,4,9-tetrahydro-1H-carbazole-4-carboxylic acid |
| SMILES | O=C(O)C1CCC(CCOCc2ccccc2)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C22H23NO3/c24-22(25)18-11-10-16(12-13-26-14-15-6-2-1-3-7-15)21-20(18)17-8-4-5-9-19(17)23-21/h1-9,16,18,23H,10-14H2,(H,24,25) |
| InChIKey | BUAWFVGKQZTGID-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|