C17H18FN7 — CID 152757593
4-cyclobutyl-2-N-(6-fluoro-3-pyridinyl)-6-pyridin-2-yl-1H-1,3,5-triazine-2,4-diamine (PubChem CID 152757593) has the molecular formula C17H18FN7 and a molecular weight of 339.38 g/mol. Its IUPAC name is 4-cyclobutyl-2-N-(6-fluoro-3-pyridinyl)-6-pyridin-2-yl-1H-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-cyclobutyl-2-N-(6-fluoro-3-pyridinyl)-6-pyridin-2-yl-1H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 152757593 |
| Molecular Formula | C17H18FN7 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-cyclobutyl-2-N-(6-fluoro-3-pyridinyl)-6-pyridin-2-yl-1H-1,3,5-triazine-2,4-diamine |
| SMILES | NC1(C2CCC2)N=C(Nc2ccc(F)nc2)NC(c2ccccn2)=N1 |
| InChI | InChI=1S/C17H18FN7/c18-14-8-7-12(10-21-14)22-16-23-15(13-6-1-2-9-20-13)24-17(19,25-16)11-4-3-5-11/h1-2,6-11H,3-5,19H2,(H2,22,23,24,25) |
| InChIKey | JHLGRWWVCPDEJZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|