C15H18F2O5P- — CID 152758125
(E)-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]but-2-enoate (PubChem CID 152758125) has the molecular formula C15H18F2O5P- and a molecular weight of 347.27 g/mol. Its IUPAC name is (E)-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]but-2-enoate.
| Compound Name | (E)-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]but-2-enoate |
|---|---|
| PubChem CID | 152758125 |
| Molecular Formula | C15H18F2O5P- |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (E)-3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]but-2-enoate |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(/C(C)=C/C(=O)[O-])cc1 |
| InChI | InChI=1S/C15H19F2O5P/c1-4-21-23(20,22-5-2)15(16,17)13-8-6-12(7-9-13)11(3)10-14(18)19/h6-10H,4-5H2,1-3H3,(H,18,19)/p-1/b11-10+ |
| InChIKey | WOJXMBKZINQVNV-ZHACJKMWSA-M |
| XLogP | 3.16 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|