C16H12ClFN2 — CID 152758493
11-chloro-2-fluoro-5-methyl-4a,5b-dihydroindolo[3,2-b]quinoline (PubChem CID 152758493) has the molecular formula C16H12ClFN2 and a molecular weight of 286.74 g/mol. Its IUPAC name is 11-chloro-2-fluoro-5-methyl-4a,5b-dihydroindolo[3,2-b]quinoline.
| Compound Name | 11-chloro-2-fluoro-5-methyl-4a,5b-dihydroindolo[3,2-b]quinoline |
|---|---|
| PubChem CID | 152758493 |
| Molecular Formula | C16H12ClFN2 |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 11-chloro-2-fluoro-5-methyl-4a,5b-dihydroindolo[3,2-b]quinoline |
| SMILES | CN1C2=C(N=C3C=CC=CC32)C(Cl)=C2C=C(F)C=CC21 |
| InChI | InChI=1S/C16H12ClFN2/c1-20-13-7-6-9(18)8-11(13)14(17)15-16(20)10-4-2-3-5-12(10)19-15/h2-8,10,13H,1H3 |
| InChIKey | FQWKIAZOFPGFKH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |