C14H13NO2 — CID 152758645
3,17-dioxa-15-azabicyclo[12.3.0]heptadeca-1,4,6,8,10,12,14-heptaene (PubChem CID 152758645) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3,17-dioxa-15-azabicyclo[12.3.0]heptadeca-1,4,6,8,10,12,14-heptaene.
| Compound Name | 3,17-dioxa-15-azabicyclo[12.3.0]heptadeca-1,4,6,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 152758645 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3,17-dioxa-15-azabicyclo[12.3.0]heptadeca-1,4,6,8,10,12,14-heptaene |
| SMILES | C1=CC=CC=CC2=NCOC2=COC=CC=C1 |
| InChI | InChI=1S/C14H13NO2/c1-2-4-6-8-10-16-11-14-13(15-12-17-14)9-7-5-3-1/h1-11H,12H2 |
| InChIKey | MRHRWHMFBWCWNR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |