About 2H-selenopheno[3,2-g]chromene
2H-selenopheno[3,2-g]chromene (PubChem CID 152758653) has the molecular formula C11H8OSe
and a molecular weight of 235.14 g/mol. Its IUPAC name is 2H-selenopheno[3,2-g]chromene.
Molecular Properties
| Compound Name | 2H-selenopheno[3,2-g]chromene |
| PubChem CID | 152758653 |
| Molecular Formula | C11H8OSe |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 2H-selenopheno[3,2-g]chromene |
| SMILES | C1=Cc2cc3cc[se]c3cc2OC1 |
| InChI | InChI=1S/C11H8OSe/c1-2-8-6-9-3-5-13-11(9)7-10(8)12-4-1/h1-3,5-7H,4H2 |
| InChIKey | CSNCIRLINFXNNZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2H-selenopheno[3,2-g]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-selenopheno[3,2-g]chromene?
The IUPAC name of 2H-selenopheno[3,2-g]chromene (CID 152758653) is 2H-selenopheno[3,2-g]chromene.
What is the SMILES notation for 2H-selenopheno[3,2-g]chromene?
The canonical SMILES for 2H-selenopheno[3,2-g]chromene is C1=Cc2cc3cc[se]c3cc2OC1.
What is the InChIKey of 2H-selenopheno[3,2-g]chromene?
The InChIKey is CSNCIRLINFXNNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8OSe/c1-2-8-6-9-3-5-13-11(9)7-10(8)12-4-1/h1-3,5-7H,4H2.
What are the key properties of 2H-selenopheno[3,2-g]chromene?
2H-selenopheno[3,2-g]chromene has a molecular weight of 235.14 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-selenopheno[3,2-g]chromene is sourced from PubChem (CID 152758653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).