C15H26O2 — CID 15275881
1-[(1S,3aR,7S,7aS)-3a-hydroxy-7,7a-dimethyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]-2-methylpropan-1-one (PubChem CID 15275881) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-[(1S,3aR,7S,7aS)-3a-hydroxy-7,7a-dimethyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(1S,3aR,7S,7aS)-3a-hydroxy-7,7a-dimethyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 15275881 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1-[(1S,3aR,7S,7aS)-3a-hydroxy-7,7a-dimethyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)[C@H]1CC[C@]2(O)CCC[C@H](C)[C@@]12C |
| InChI | InChI=1S/C15H26O2/c1-10(2)13(16)12-7-9-15(17)8-5-6-11(3)14(12,15)4/h10-12,17H,5-9H2,1-4H3/t11-,12+,14-,15+/m0/s1 |
| InChIKey | HUQLDUXYHVFPRA-MYZSUADSSA-N |
| XLogP | 3.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |