C14H12N4OS — CID 152760161
N-(nitrosomethyl)-5-phenyl-1,3-dihydrothieno[3,2-e][1,4]diazepin-2-imine (PubChem CID 152760161) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is N-(nitrosomethyl)-5-phenyl-1,3-dihydrothieno[3,2-e][1,4]diazepin-2-imine.
| Compound Name | N-(nitrosomethyl)-5-phenyl-1,3-dihydrothieno[3,2-e][1,4]diazepin-2-imine |
|---|---|
| PubChem CID | 152760161 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-(nitrosomethyl)-5-phenyl-1,3-dihydrothieno[3,2-e][1,4]diazepin-2-imine |
| SMILES | O=NCN=C1CN=C(c2ccccc2)c2sccc2N1 |
| InChI | InChI=1S/C14H12N4OS/c19-17-9-16-12-8-15-13(10-4-2-1-3-5-10)14-11(18-12)6-7-20-14/h1-7H,8-9H2,(H,16,18) |
| InChIKey | WAQXEXNGCAPWBE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|