C18H25NO2S — CID 15276043
(1S,2S,4R)-4-methyl-6-methylidene-2-[(N-methyl-S-phenylsulfonimidoyl)methyl]bicyclo[2.2.2]octan-2-ol (PubChem CID 15276043) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is (1S,2S,4R)-4-methyl-6-methylidene-2-[(N-methyl-S-phenylsulfonimidoyl)methyl]bicyclo[2.2.2]octan-2-ol.
| Compound Name | (1S,2S,4R)-4-methyl-6-methylidene-2-[(N-methyl-S-phenylsulfonimidoyl)methyl]bicyclo[2.2.2]octan-2-ol |
|---|---|
| PubChem CID | 15276043 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (1S,2S,4R)-4-methyl-6-methylidene-2-[(N-methyl-S-phenylsulfonimidoyl)methyl]bicyclo[2.2.2]octan-2-ol |
| SMILES | C=C1C[C@@]2(C)CC[C@@H]1[C@](O)(CS(=O)(=NC)c1ccccc1)C2 |
| InChI | InChI=1S/C18H25NO2S/c1-14-11-17(2)10-9-16(14)18(20,12-17)13-22(21,19-3)15-7-5-4-6-8-15/h4-8,16,20H,1,9-13H2,2-3H3/t16-,17+,18+,22?/m0/s1 |
| InChIKey | BEDOXNPCQZRUQI-UBTYJOTCSA-N |
| XLogP | 3.64 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|