C20H34O5Si — CID 15276064
(1R,2R,3R,7S,9E,11R)-11-hydroxy-1-methyl-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradec-9-en-5-one (PubChem CID 15276064) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is (1R,2R,3R,7S,9E,11R)-11-hydroxy-1-methyl-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradec-9-en-5-one.
| Compound Name | (1R,2R,3R,7S,9E,11R)-11-hydroxy-1-methyl-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradec-9-en-5-one |
|---|---|
| PubChem CID | 15276064 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | (1R,2R,3R,7S,9E,11R)-11-hydroxy-1-methyl-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradec-9-en-5-one |
| SMILES | C[C@]12CC[C@@H](O)/C(=C/C[C@H]3CC(=O)O[C@H]3[C@@H]1OCOCC[Si](C)(C)C)C2 |
| InChI | InChI=1S/C20H34O5Si/c1-20-8-7-16(21)15(12-20)6-5-14-11-17(22)25-18(14)19(20)24-13-23-9-10-26(2,3)4/h6,14,16,18-19,21H,5,7-13H2,1-4H3/b15-6+/t14-,16+,18+,19-,20+/m0/s1 |
| InChIKey | WSGBSGDJVAQRGZ-HFLOOLSXSA-N |
| XLogP | 3.50 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|