C10H19N3O2 — CID 152761871
(Z,2S)-2-amino-6-(1-aminoethylideneamino)-5-methylhept-4-enoic acid (PubChem CID 152761871) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is (Z,2S)-2-amino-6-(1-aminoethylideneamino)-5-methylhept-4-enoic acid.
| Compound Name | (Z,2S)-2-amino-6-(1-aminoethylideneamino)-5-methylhept-4-enoic acid |
|---|---|
| PubChem CID | 152761871 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (Z,2S)-2-amino-6-(1-aminoethylideneamino)-5-methylhept-4-enoic acid |
| SMILES | C/C(=C/C[C@H](N)C(=O)O)C(C)/N=C(\C)N |
| InChI | InChI=1S/C10H19N3O2/c1-6(7(2)13-8(3)11)4-5-9(12)10(14)15/h4,7,9H,5,12H2,1-3H3,(H2,11,13)(H,14,15)/b6-4-/t7?,9-/m0/s1 |
| InChIKey | WRQLVOMSNZSMFJ-KRTZWNJSSA-N |
| XLogP | 0.50 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|