About phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate
phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate (PubChem CID 152762207) has the molecular formula C8H5F4O6PS-2
and a molecular weight of 336.16 g/mol. Its IUPAC name is phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 152762207 |
| Molecular Formula | C8H5F4O6PS-2 |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate |
| SMILES | O=P([O-])([O-])COS(=O)(=O)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C8H7F4O6PS/c9-5-1-2-7(6(3-5)8(10,11)12)20(16,17)18-4-19(13,14)15/h1-3H,4H2,(H2,13,14,15)/p-2 |
| InChIKey | RPLVUWYQLROZMF-UHFFFAOYSA-L |
| XLogP | 0.42 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate?
The IUPAC name of phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate (CID 152762207) is phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate is O=P([O-])([O-])COS(=O)(=O)c1ccc(F)cc1C(F)(F)F.
What is the InChIKey of phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate?
The InChIKey is RPLVUWYQLROZMF-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H7F4O6PS/c9-5-1-2-7(6(3-5)8(10,11)12)20(16,17)18-4-19(13,14)15/h1-3H,4H2,(H2,13,14,15)/p-2.
What are the key properties of phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate?
phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate has a molecular weight of 336.16 g/mol, XLogP of 0.42, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phosphonatomethyl 4-fluoro-2-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 152762207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).