About 2-ethenyl-3,4-dimethylselenophene
2-ethenyl-3,4-dimethylselenophene (PubChem CID 152762273) has the molecular formula C8H10Se
and a molecular weight of 185.13 g/mol. Its IUPAC name is 2-ethenyl-3,4-dimethylselenophene.
Molecular Properties
| Compound Name | 2-ethenyl-3,4-dimethylselenophene |
| PubChem CID | 152762273 |
| Molecular Formula | C8H10Se |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | 2-ethenyl-3,4-dimethylselenophene |
| SMILES | C=Cc1[se]cc(C)c1C |
| InChI | InChI=1S/C8H10Se/c1-4-8-7(3)6(2)5-9-8/h4-5H,1H2,2-3H3 |
| InChIKey | HGBWZBATHGYBEQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-3,4-dimethylselenophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-3,4-dimethylselenophene?
The IUPAC name of 2-ethenyl-3,4-dimethylselenophene (CID 152762273) is 2-ethenyl-3,4-dimethylselenophene.
What is the SMILES notation for 2-ethenyl-3,4-dimethylselenophene?
The canonical SMILES for 2-ethenyl-3,4-dimethylselenophene is C=Cc1[se]cc(C)c1C.
What is the InChIKey of 2-ethenyl-3,4-dimethylselenophene?
The InChIKey is HGBWZBATHGYBEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Se/c1-4-8-7(3)6(2)5-9-8/h4-5H,1H2,2-3H3.
What are the key properties of 2-ethenyl-3,4-dimethylselenophene?
2-ethenyl-3,4-dimethylselenophene has a molecular weight of 185.13 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-3,4-dimethylselenophene is sourced from PubChem (CID 152762273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).