C24H32O5 — CID 15276244
2-[(1R)-6-methoxy-7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 15276244) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[(1R)-6-methoxy-7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | 2-[(1R)-6-methoxy-7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 15276244 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-[(1R)-6-methoxy-7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | COc1cc2c(cc1C)[C@@H](CCOC(=O)[C@@]13CC[C@@](C)(C(=O)O1)C3(C)C)CCC2 |
| InChI | InChI=1S/C24H32O5/c1-15-13-18-16(7-6-8-17(18)14-19(15)27-5)9-12-28-21(26)24-11-10-23(4,20(25)29-24)22(24,2)3/h13-14,16H,6-12H2,1-5H3/t16-,23+,24-/m1/s1 |
| InChIKey | YERJQQFEVFBOAJ-QQTNTEGQSA-N |
| XLogP | 4.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |