C17H20O2 — CID 152765288
8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-4,10,15-trien-14-one (PubChem CID 152765288) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-4,10,15-trien-14-one.
| Compound Name | 8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-4,10,15-trien-14-one |
|---|---|
| PubChem CID | 152765288 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-4,10,15-trien-14-one |
| SMILES | O=C1C=C2CCC3C(=C2CC1)COCC1C=CCC13 |
| InChI | InChI=1S/C17H20O2/c18-13-5-7-15-11(8-13)4-6-16-14-3-1-2-12(14)9-19-10-17(15)16/h1-2,8,12,14,16H,3-7,9-10H2 |
| InChIKey | HXOIOAYOSACESC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|