About 1-methoxy-2H-1,3-diazecin-7-ol
1-methoxy-2H-1,3-diazecin-7-ol (PubChem CID 152767264) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-methoxy-2H-1,3-diazecin-7-ol.
Molecular Properties
| Compound Name | 1-methoxy-2H-1,3-diazecin-7-ol |
| PubChem CID | 152767264 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-methoxy-2H-1,3-diazecin-7-ol |
| SMILES | CON1C=CC=C(O)C=CC=NC1 |
| InChI | InChI=1S/C9H12N2O2/c1-13-11-7-3-5-9(12)4-2-6-10-8-11/h2-7,12H,8H2,1H3 |
| InChIKey | QFQGDGKUPKWGDP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxy-2H-1,3-diazecin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2H-1,3-diazecin-7-ol?
The IUPAC name of 1-methoxy-2H-1,3-diazecin-7-ol (CID 152767264) is 1-methoxy-2H-1,3-diazecin-7-ol.
What is the SMILES notation for 1-methoxy-2H-1,3-diazecin-7-ol?
The canonical SMILES for 1-methoxy-2H-1,3-diazecin-7-ol is CON1C=CC=C(O)C=CC=NC1.
What is the InChIKey of 1-methoxy-2H-1,3-diazecin-7-ol?
The InChIKey is QFQGDGKUPKWGDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-13-11-7-3-5-9(12)4-2-6-10-8-11/h2-7,12H,8H2,1H3.
What are the key properties of 1-methoxy-2H-1,3-diazecin-7-ol?
1-methoxy-2H-1,3-diazecin-7-ol has a molecular weight of 180.21 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2H-1,3-diazecin-7-ol is sourced from PubChem (CID 152767264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).