About N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine
N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine (PubChem CID 152768456) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine |
| PubChem CID | 152768456 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine |
| SMILES | ON=C1CC[C@@H](c2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C18H19NO/c20-19-16-11-12-17(14-7-3-1-4-8-14)18(13-16)15-9-5-2-6-10-15/h1-10,17-18,20H,11-13H2/t17-,18-/m0/s1 |
| InChIKey | FLAREEUHPXSCHB-ROUUACIJSA-N |
| XLogP | 4.57 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine?
The IUPAC name of N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine (CID 152768456) is N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine.
What is the SMILES notation for N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine?
The canonical SMILES for N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine is ON=C1CC[C@@H](c2ccccc2)[C@H](c2ccccc2)C1.
What is the InChIKey of N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine?
The InChIKey is FLAREEUHPXSCHB-ROUUACIJSA-N. The full InChI is InChI=1S/C18H19NO/c20-19-16-11-12-17(14-7-3-1-4-8-14)18(13-16)15-9-5-2-6-10-15/h1-10,17-18,20H,11-13H2/t17-,18-/m0/s1.
What are the key properties of N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine?
N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine has a molecular weight of 265.36 g/mol, XLogP of 4.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4R)-3,4-diphenylcyclohexylidene]hydroxylamine is sourced from PubChem (CID 152768456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).