About [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate
[1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 152769984) has the molecular formula C25H28NO3S2+
and a molecular weight of 454.64 g/mol. Its IUPAC name is [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
Molecular Properties
| Compound Name | [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| PubChem CID | 152769984 |
| Molecular Formula | C25H28NO3S2+ |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | CC(c1ccccc1)[N+]12CCC(OC(=O)C(O)(c3cccs3)c3cccs3)(CC1)CC2 |
| InChI | InChI=1S/C25H28NO3S2/c1-19(20-7-3-2-4-8-20)26-14-11-24(12-15-26,13-16-26)29-23(27)25(28,21-9-5-17-30-21)22-10-6-18-31-22/h2-10,17-19,28H,11-16H2,1H3/q+1 |
| InChIKey | CGXUXXWCFRCLCU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate?
The IUPAC name of [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (CID 152769984) is [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
What is the SMILES notation for [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate?
The canonical SMILES for [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate is CC(c1ccccc1)[N+]12CCC(OC(=O)C(O)(c3cccs3)c3cccs3)(CC1)CC2.
What is the InChIKey of [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate?
The InChIKey is CGXUXXWCFRCLCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28NO3S2/c1-19(20-7-3-2-4-8-20)26-14-11-24(12-15-26,13-16-26)29-23(27)25(28,21-9-5-17-30-21)22-10-6-18-31-22/h2-10,17-19,28H,11-16H2,1H3/q+1.
What are the key properties of [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate?
[1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate has a molecular weight of 454.64 g/mol, XLogP of 5.10, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-4-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate is sourced from PubChem (CID 152769984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).