About 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine
4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine (PubChem CID 152770299) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine |
| PubChem CID | 152770299 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine |
| SMILES | CC(C)(C)CCC1(N)C=CNC(N)=N1 |
| InChI | InChI=1S/C10H20N4/c1-9(2,3)4-5-10(12)6-7-13-8(11)14-10/h6-7H,4-5,12H2,1-3H3,(H3,11,13,14) |
| InChIKey | FJZSVCHNXDQKGB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine?
The IUPAC name of 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine (CID 152770299) is 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine.
What is the SMILES notation for 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine?
The canonical SMILES for 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine is CC(C)(C)CCC1(N)C=CNC(N)=N1.
What is the InChIKey of 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine?
The InChIKey is FJZSVCHNXDQKGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-9(2,3)4-5-10(12)6-7-13-8(11)14-10/h6-7H,4-5,12H2,1-3H3,(H3,11,13,14).
What are the key properties of 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine?
4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine has a molecular weight of 196.30 g/mol, XLogP of 0.90, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethylbutyl)-1H-pyrimidine-2,4-diamine is sourced from PubChem (CID 152770299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).