About 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one
4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one (PubChem CID 152771258) has the molecular formula C16H12ClN5O
and a molecular weight of 325.76 g/mol. Its IUPAC name is 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one.
Molecular Properties
| Compound Name | 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
| PubChem CID | 152771258 |
| Molecular Formula | C16H12ClN5O |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
| SMILES | O=C1NN=C(c2cnccn2)C1=Cc1cc2c([nH]1)CCC=C2Cl |
| InChI | InChI=1S/C16H12ClN5O/c17-12-2-1-3-13-10(12)6-9(20-13)7-11-15(21-22-16(11)23)14-8-18-4-5-19-14/h2,4-8,20H,1,3H2,(H,22,23) |
| InChIKey | WALHWCGWKDHAKN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one?
The IUPAC name of 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one (CID 152771258) is 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one.
What is the SMILES notation for 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one?
The canonical SMILES for 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one is O=C1NN=C(c2cnccn2)C1=Cc1cc2c([nH]1)CCC=C2Cl.
What is the InChIKey of 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one?
The InChIKey is WALHWCGWKDHAKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClN5O/c17-12-2-1-3-13-10(12)6-9(20-13)7-11-15(21-22-16(11)23)14-8-18-4-5-19-14/h2,4-8,20H,1,3H2,(H,22,23).
What are the key properties of 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one?
4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one has a molecular weight of 325.76 g/mol, XLogP of 2.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chloro-6,7-dihydro-1H-indol-2-yl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one is sourced from PubChem (CID 152771258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).