C16H15ClFN3O4 — CID 152771262
6-amino-6-(4-chlorobenzoyl)-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1H-pyrimidin-2-one (PubChem CID 152771262) has the molecular formula C16H15ClFN3O4 and a molecular weight of 367.76 g/mol. Its IUPAC name is 6-amino-6-(4-chlorobenzoyl)-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1H-pyrimidin-2-one.
| Compound Name | 6-amino-6-(4-chlorobenzoyl)-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 152771262 |
| Molecular Formula | C16H15ClFN3O4 |
| Molecular Weight | 367.76 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 6-amino-6-(4-chlorobenzoyl)-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1H-pyrimidin-2-one |
| SMILES | NC1(C(=O)c2ccc(Cl)cc2)NC(=O)N([C@H]2C=C[C@@H](CO)O2)C=C1F |
| InChI | InChI=1S/C16H15ClFN3O4/c17-10-3-1-9(2-4-10)14(23)16(19)12(18)7-21(15(24)20-16)13-6-5-11(8-22)25-13/h1-7,11,13,22H,8,19H2,(H,20,24)/t11-,13+,16?/m0/s1 |
| InChIKey | VCLLXLWPTDLADT-OBNKUBODSA-N |
| XLogP | 1.29 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.76 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|