About ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate
ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate (PubChem CID 152771338) has the molecular formula C8H13F2NO3
and a molecular weight of 209.19 g/mol. Its IUPAC name is ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate |
| PubChem CID | 152771338 |
| Molecular Formula | C8H13F2NO3 |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate |
| SMILES | CCOC(=O)C(C)(C)C(=NO)C(F)F |
| InChI | InChI=1S/C8H13F2NO3/c1-4-14-7(12)8(2,3)5(11-13)6(9)10/h6,13H,4H2,1-3H3 |
| InChIKey | KJRUWJLZCCKCGY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate?
The IUPAC name of ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate (CID 152771338) is ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate.
What is the SMILES notation for ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate?
The canonical SMILES for ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate is CCOC(=O)C(C)(C)C(=NO)C(F)F.
What is the InChIKey of ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate?
The InChIKey is KJRUWJLZCCKCGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO3/c1-4-14-7(12)8(2,3)5(11-13)6(9)10/h6,13H,4H2,1-3H3.
What are the key properties of ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate?
ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate has a molecular weight of 209.19 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4,4-difluoro-3-hydroxyimino-2,2-dimethylbutanoate is sourced from PubChem (CID 152771338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).