C13H20O5 — CID 15277202
diethyl 2-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanedioate (PubChem CID 15277202) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is diethyl 2-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanedioate.
| Compound Name | diethyl 2-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanedioate |
|---|---|
| PubChem CID | 15277202 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | diethyl 2-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H]1C=C[C@@H](CO)C1 |
| InChI | InChI=1S/C13H20O5/c1-3-17-12(15)11(13(16)18-4-2)10-6-5-9(7-10)8-14/h5-6,9-11,14H,3-4,7-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | WYFRINNMQLXWBB-ZJUUUORDSA-N |
| XLogP | 0.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|