C22H31Cl2N5O4S2 — CID 152774382
2-[2-[[N-[1-amino-2-(2,3-dichlorophenyl)-2-iminoethylidene]carbamimidoyl]carbamoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate (PubChem CID 152774382) has the molecular formula C22H31Cl2N5O4S2 and a molecular weight of 564.56 g/mol. Its IUPAC name is 2-[2-[[N-[1-amino-2-(2,3-dichlorophenyl)-2-iminoethylidene]carbamimidoyl]carbamoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate.
| Compound Name | 2-[2-[[N-[1-amino-2-(2,3-dichlorophenyl)-2-iminoethylidene]carbamimidoyl]carbamoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate |
|---|---|
| PubChem CID | 152774382 |
| Molecular Formula | C22H31Cl2N5O4S2 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 2-[2-[[N-[1-amino-2-(2,3-dichlorophenyl)-2-iminoethylidene]carbamimidoyl]carbamoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate |
| SMILES | [H]/N=C(\C(N)=N/C(=N/[H])NC(=O)OCCSSCCOC(=O)C(CCC)CCC)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H31Cl2N5O4S2/c1-3-6-14(7-4-2)20(30)32-10-12-34-35-13-11-33-22(31)29-21(27)28-19(26)18(25)15-8-5-9-16(23)17(15)24/h5,8-9,14,25H,3-4,6-7,10-13H2,1-2H3,(H4,26,27,28,29,31)/b25-18- |
| InChIKey | BVGMXZGZGPHNLY-BWAHOGKJSA-N |
| XLogP | 5.52 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|