About 5-ethyl-2-imino-1,3-oxazolidin-4-one
5-ethyl-2-imino-1,3-oxazolidin-4-one (PubChem CID 152774400) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 5-ethyl-2-imino-1,3-oxazolidin-4-one.
Molecular Properties
| Compound Name | 5-ethyl-2-imino-1,3-oxazolidin-4-one |
| PubChem CID | 152774400 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 5-ethyl-2-imino-1,3-oxazolidin-4-one |
| SMILES | [H]/N=C1/NC(=O)C(CC)O1 |
| InChI | InChI=1S/C5H8N2O2/c1-2-3-4(8)7-5(6)9-3/h3H,2H2,1H3,(H2,6,7,8) |
| InChIKey | IACQRCBCTXPIEP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2-imino-1,3-oxazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-imino-1,3-oxazolidin-4-one?
The IUPAC name of 5-ethyl-2-imino-1,3-oxazolidin-4-one (CID 152774400) is 5-ethyl-2-imino-1,3-oxazolidin-4-one.
What is the SMILES notation for 5-ethyl-2-imino-1,3-oxazolidin-4-one?
The canonical SMILES for 5-ethyl-2-imino-1,3-oxazolidin-4-one is [H]/N=C1/NC(=O)C(CC)O1.
What is the InChIKey of 5-ethyl-2-imino-1,3-oxazolidin-4-one?
The InChIKey is IACQRCBCTXPIEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-2-3-4(8)7-5(6)9-3/h3H,2H2,1H3,(H2,6,7,8).
What are the key properties of 5-ethyl-2-imino-1,3-oxazolidin-4-one?
5-ethyl-2-imino-1,3-oxazolidin-4-one has a molecular weight of 128.13 g/mol, XLogP of -0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-imino-1,3-oxazolidin-4-one is sourced from PubChem (CID 152774400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).