C22H18Cl2O2 — CID 152776118
(1R,5S)-3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one (PubChem CID 152776118) has the molecular formula C22H18Cl2O2 and a molecular weight of 385.29 g/mol. Its IUPAC name is (1R,5S)-3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one.
| Compound Name | (1R,5S)-3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one |
|---|---|
| PubChem CID | 152776118 |
| Molecular Formula | C22H18Cl2O2 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | (1R,5S)-3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.1]octa-3,6-dien-2-one |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2Cl)cc1C1=C(O)[C@@H]2C=C[C@@H](C2)C1=O |
| InChI | InChI=1S/C22H18Cl2O2/c1-2-12-3-4-13(17-8-7-16(23)11-19(17)24)10-18(12)20-21(25)14-5-6-15(9-14)22(20)26/h3-8,10-11,14-15,25H,2,9H2,1H3/t14-,15+/m1/s1 |
| InChIKey | QGEXJKSEPULFCM-CABCVRRESA-N |
| XLogP | 6.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|