C18H25N7O5S — CID 152777549
(4-acetamidophenyl) [2-acetamido-3-[[N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]amino]-3-oxopropyl]sulfanylformate (PubChem CID 152777549) has the molecular formula C18H25N7O5S and a molecular weight of 451.51 g/mol. Its IUPAC name is (4-acetamidophenyl) [2-acetamido-3-[[N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]amino]-3-oxopropyl]sulfanylformate.
| Compound Name | (4-acetamidophenyl) [2-acetamido-3-[[N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]amino]-3-oxopropyl]sulfanylformate |
|---|---|
| PubChem CID | 152777549 |
| Molecular Formula | C18H25N7O5S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (4-acetamidophenyl) [2-acetamido-3-[[N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]amino]-3-oxopropyl]sulfanylformate |
| SMILES | [H]/N=C(/N=C(N)NC(=O)C(CSC(=O)Oc1ccc(NC(C)=O)cc1)NC(C)=O)N(C)C |
| InChI | InChI=1S/C18H25N7O5S/c1-10(26)21-12-5-7-13(8-6-12)30-18(29)31-9-14(22-11(2)27)15(28)23-16(19)24-17(20)25(3)4/h5-8,14H,9H2,1-4H3,(H,21,26)(H,22,27)(H4,19,20,23,24,28) |
| InChIKey | OOPMDWMUJZQXGE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 179.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|