About 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine
4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine (PubChem CID 152778788) has the molecular formula C9H3ClFN3S
and a molecular weight of 239.66 g/mol. Its IUPAC name is 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine.
Molecular Properties
| Compound Name | 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine |
| PubChem CID | 152778788 |
| Molecular Formula | C9H3ClFN3S |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine |
| SMILES | Fc1ccc2c(c1)sc1c(Cl)nnnc12 |
| InChI | InChI=1S/C9H3ClFN3S/c10-9-8-7(12-14-13-9)5-2-1-4(11)3-6(5)15-8/h1-3H |
| InChIKey | PJAHLKAUZKRUTB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine?
The IUPAC name of 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine (CID 152778788) is 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine.
What is the SMILES notation for 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine?
The canonical SMILES for 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine is Fc1ccc2c(c1)sc1c(Cl)nnnc12.
What is the InChIKey of 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine?
The InChIKey is PJAHLKAUZKRUTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3ClFN3S/c10-9-8-7(12-14-13-9)5-2-1-4(11)3-6(5)15-8/h1-3H.
What are the key properties of 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine?
4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine has a molecular weight of 239.66 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7-fluoro-[1]benzothiolo[3,2-d]triazine is sourced from PubChem (CID 152778788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).